C21H22O14 — CID 141227340
2-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]-1,3-bis(3,4,5-trihydroxyphenyl)propane-1,3-dione (PubChem CID 141227340) has the molecular formula C21H22O14 and a molecular weight of 498.39 g/mol. Its IUPAC name is 2-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]-1,3-bis(3,4,5-trihydroxyphenyl)propane-1,3-dione.
| Compound Name | 2-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]-1,3-bis(3,4,5-trihydroxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 141227340 |
| Molecular Formula | C21H22O14 |
| Molecular Weight | 498.39 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 2-[[(2R,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxan-2-yl]methoxy]-1,3-bis(3,4,5-trihydroxyphenyl)propane-1,3-dione |
| SMILES | O=C(c1cc(O)c(O)c(O)c1)C(OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O)C(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C21H22O14/c22-8-1-6(2-9(23)15(8)28)13(26)20(14(27)7-3-10(24)16(29)11(25)4-7)34-5-12-17(30)18(31)19(32)21(33)35-12/h1-4,12,17-25,28-33H,5H2/t12-,17-,18+,19-,21-/m1/s1 |
| InChIKey | ZPZYVVKBCWAARY-CMWYNCEASA-N |
| XLogP | -1.83 |
| TPSA | 254.90 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.39 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|