C15H22O6 — CID 23241291
2-[(1R,2R,3R,4S,6S)-3-(1-carboxyethenyl)-4-ethenyl-2,6-dihydroxy-4-methylcyclohexyl]propanoic acid (PubChem CID 23241291) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-[(1R,2R,3R,4S,6S)-3-(1-carboxyethenyl)-4-ethenyl-2,6-dihydroxy-4-methylcyclohexyl]propanoic acid.
| Compound Name | 2-[(1R,2R,3R,4S,6S)-3-(1-carboxyethenyl)-4-ethenyl-2,6-dihydroxy-4-methylcyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 23241291 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 2-[(1R,2R,3R,4S,6S)-3-(1-carboxyethenyl)-4-ethenyl-2,6-dihydroxy-4-methylcyclohexyl]propanoic acid |
| SMILES | C=C[C@]1(C)C[C@H](O)[C@@H](C(C)C(=O)O)[C@H](O)[C@H]1C(=C)C(=O)O |
| InChI | InChI=1S/C15H22O6/c1-5-15(4)6-9(16)10(7(2)13(18)19)12(17)11(15)8(3)14(20)21/h5,7,9-12,16-17H,1,3,6H2,2,4H3,(H,18,19)(H,20,21)/t7?,9-,10+,11+,12-,15+/m0/s1 |
| InChIKey | GTWQZXRKNBJSLS-URJLNCTBSA-N |
| XLogP | 0.90 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|