C19H28O7 — CID 163157797
2-[(1S,2S,3R,4S,6S)-4-ethenyl-2-hydroxy-6-[(2R)-3-hydroxy-2-methylpropanoyl]oxy-3-(3-hydroxyprop-1-en-2-yl)-4-methylcyclohexyl]prop-2-enoic acid (PubChem CID 163157797) has the molecular formula C19H28O7 and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-[(1S,2S,3R,4S,6S)-4-ethenyl-2-hydroxy-6-[(2R)-3-hydroxy-2-methylpropanoyl]oxy-3-(3-hydroxyprop-1-en-2-yl)-4-methylcyclohexyl]prop-2-enoic acid.
| Compound Name | 2-[(1S,2S,3R,4S,6S)-4-ethenyl-2-hydroxy-6-[(2R)-3-hydroxy-2-methylpropanoyl]oxy-3-(3-hydroxyprop-1-en-2-yl)-4-methylcyclohexyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 163157797 |
| Molecular Formula | C19H28O7 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-[(1S,2S,3R,4S,6S)-4-ethenyl-2-hydroxy-6-[(2R)-3-hydroxy-2-methylpropanoyl]oxy-3-(3-hydroxyprop-1-en-2-yl)-4-methylcyclohexyl]prop-2-enoic acid |
| SMILES | C=C[C@]1(C)C[C@H](OC(=O)[C@H](C)CO)[C@@H](C(=C)C(=O)O)[C@@H](O)[C@H]1C(=C)CO |
| InChI | InChI=1S/C19H28O7/c1-6-19(5)7-13(26-18(25)11(3)9-21)14(12(4)17(23)24)16(22)15(19)10(2)8-20/h6,11,13-16,20-22H,1-2,4,7-9H2,3,5H3,(H,23,24)/t11-,13+,14-,15-,16-,19-/m1/s1 |
| InChIKey | PUOWNDUGNUNIQF-HAYZIVMFSA-N |
| XLogP | 0.91 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|