C19H22O8 — CID 162893543
2-[(4aR,5R,6S,7S,8aR)-8a-ethenyl-5-hydroxy-7-[2-(hydroxymethyl)prop-2-enoyloxy]-4-methylidene-3-oxo-1,4a,5,6,7,8-hexahydroisochromen-6-yl]prop-2-enoic acid (PubChem CID 162893543) has the molecular formula C19H22O8 and a molecular weight of 378.38 g/mol. Its IUPAC name is 2-[(4aR,5R,6S,7S,8aR)-8a-ethenyl-5-hydroxy-7-[2-(hydroxymethyl)prop-2-enoyloxy]-4-methylidene-3-oxo-1,4a,5,6,7,8-hexahydroisochromen-6-yl]prop-2-enoic acid.
| Compound Name | 2-[(4aR,5R,6S,7S,8aR)-8a-ethenyl-5-hydroxy-7-[2-(hydroxymethyl)prop-2-enoyloxy]-4-methylidene-3-oxo-1,4a,5,6,7,8-hexahydroisochromen-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 162893543 |
| Molecular Formula | C19H22O8 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 2-[(4aR,5R,6S,7S,8aR)-8a-ethenyl-5-hydroxy-7-[2-(hydroxymethyl)prop-2-enoyloxy]-4-methylidene-3-oxo-1,4a,5,6,7,8-hexahydroisochromen-6-yl]prop-2-enoic acid |
| SMILES | C=C[C@@]12COC(=O)C(=C)[C@@H]1[C@@H](O)[C@H](C(=C)C(=O)O)[C@@H](OC(=O)C(=C)CO)C2 |
| InChI | InChI=1S/C19H22O8/c1-5-19-6-12(27-17(24)9(2)7-20)13(10(3)16(22)23)15(21)14(19)11(4)18(25)26-8-19/h5,12-15,20-21H,1-4,6-8H2,(H,22,23)/t12-,13+,14+,15-,19+/m0/s1 |
| InChIKey | VFWBKWFDMSNXAX-WSVVRNJXSA-N |
| XLogP | 0.37 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|