C20H28O8 — CID 14287842
[(2S,3S,4R,4aS,5R,8R,8aR)-5-formyl-4,8-dihydroxy-3-(3-methoxy-3-oxoprop-1-en-2-yl)-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-2-yl] 2-(hydroxymethyl)prop-2-enoate (PubChem CID 14287842) has the molecular formula C20H28O8 and a molecular weight of 396.44 g/mol. Its IUPAC name is [(2S,3S,4R,4aS,5R,8R,8aR)-5-formyl-4,8-dihydroxy-3-(3-methoxy-3-oxoprop-1-en-2-yl)-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-2-yl] 2-(hydroxymethyl)prop-2-enoate.
| Compound Name | [(2S,3S,4R,4aS,5R,8R,8aR)-5-formyl-4,8-dihydroxy-3-(3-methoxy-3-oxoprop-1-en-2-yl)-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-2-yl] 2-(hydroxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 14287842 |
| Molecular Formula | C20H28O8 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | [(2S,3S,4R,4aS,5R,8R,8aR)-5-formyl-4,8-dihydroxy-3-(3-methoxy-3-oxoprop-1-en-2-yl)-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-2-yl] 2-(hydroxymethyl)prop-2-enoate |
| SMILES | C=C(CO)C(=O)O[C@H]1C[C@]2(C)[C@@H]([C@@H](O)[C@@H]1C(=C)C(=O)OC)[C@H](C=O)CC[C@H]2O |
| InChI | InChI=1S/C20H28O8/c1-10(8-21)18(25)28-13-7-20(3)14(23)6-5-12(9-22)16(20)17(24)15(13)11(2)19(26)27-4/h9,12-17,21,23-24H,1-2,5-8H2,3-4H3/t12-,13-,14+,15+,16+,17-,20-/m0/s1 |
| InChIKey | AXTHWXPLSBCNCK-FYALYEGMSA-N |
| XLogP | 0.15 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|