C21H32O10 — CID 124871671
[(2R,3S,4R,4aS,5R,8R,8aS)-4,5,8-trihydroxy-5-(hydroxymethyl)-3-(3-methoxy-3-oxoprop-1-en-2-yl)-8a-methyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-2-yl] (3S)-3,4-dihydroxy-2-methylidenebutanoate (PubChem CID 124871671) has the molecular formula C21H32O10 and a molecular weight of 444.48 g/mol. Its IUPAC name is [(2R,3S,4R,4aS,5R,8R,8aS)-4,5,8-trihydroxy-5-(hydroxymethyl)-3-(3-methoxy-3-oxoprop-1-en-2-yl)-8a-methyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-2-yl] (3S)-3,4-dihydroxy-2-methylidenebutanoate.
| Compound Name | [(2R,3S,4R,4aS,5R,8R,8aS)-4,5,8-trihydroxy-5-(hydroxymethyl)-3-(3-methoxy-3-oxoprop-1-en-2-yl)-8a-methyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-2-yl] (3S)-3,4-dihydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 124871671 |
| Molecular Formula | C21H32O10 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | [(2R,3S,4R,4aS,5R,8R,8aS)-4,5,8-trihydroxy-5-(hydroxymethyl)-3-(3-methoxy-3-oxoprop-1-en-2-yl)-8a-methyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-2-yl] (3S)-3,4-dihydroxy-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OC)[C@H]1[C@@H](O)[C@H]2[C@@](O)(CO)CC[C@@H](O)[C@@]2(C)C[C@H]1OC(=O)C(=C)[C@H](O)CO |
| InChI | InChI=1S/C21H32O10/c1-10(12(24)8-22)19(28)31-13-7-20(3)14(25)5-6-21(29,9-23)17(20)16(26)15(13)11(2)18(27)30-4/h12-17,22-26,29H,1-2,5-9H2,3-4H3/t12-,13-,14-,15-,16-,17-,20-,21+/m1/s1 |
| InChIKey | RRUQYJBEEQBWGK-JUNHGDMQSA-N |
| XLogP | -1.58 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|