C20H26O7 — CID 162835664
2-[7-[2-(hydroxymethyl)prop-2-enoyloxy]-4-methylidene-3-oxo-8a-prop-2-enyl-1,4a,5,6,7,8-hexahydroisochromen-6-yl]propanoic acid (PubChem CID 162835664) has the molecular formula C20H26O7 and a molecular weight of 378.42 g/mol. Its IUPAC name is 2-[7-[2-(hydroxymethyl)prop-2-enoyloxy]-4-methylidene-3-oxo-8a-prop-2-enyl-1,4a,5,6,7,8-hexahydroisochromen-6-yl]propanoic acid.
| Compound Name | 2-[7-[2-(hydroxymethyl)prop-2-enoyloxy]-4-methylidene-3-oxo-8a-prop-2-enyl-1,4a,5,6,7,8-hexahydroisochromen-6-yl]propanoic acid |
|---|---|
| PubChem CID | 162835664 |
| Molecular Formula | C20H26O7 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-[7-[2-(hydroxymethyl)prop-2-enoyloxy]-4-methylidene-3-oxo-8a-prop-2-enyl-1,4a,5,6,7,8-hexahydroisochromen-6-yl]propanoic acid |
| SMILES | C=CCC12COC(=O)C(=C)C1CC(C(C)C(=O)O)C(OC(=O)C(=C)CO)C2 |
| InChI | InChI=1S/C20H26O7/c1-5-6-20-8-16(27-18(24)11(2)9-21)14(12(3)17(22)23)7-15(20)13(4)19(25)26-10-20/h5,12,14-16,21H,1-2,4,6-10H2,3H3,(H,22,23) |
| InChIKey | FDSOENVTTSWEDH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|