C15H18O5 — CID 74155535
5a-ethenyl-4-hydroxy-3-methyl-9-methylidene-3a,4,5,6,9a,9b-hexahydro-3H-furo[2,3-f]isochromene-2,8-dione (PubChem CID 74155535) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is 5a-ethenyl-4-hydroxy-3-methyl-9-methylidene-3a,4,5,6,9a,9b-hexahydro-3H-furo[2,3-f]isochromene-2,8-dione.
| Compound Name | 5a-ethenyl-4-hydroxy-3-methyl-9-methylidene-3a,4,5,6,9a,9b-hexahydro-3H-furo[2,3-f]isochromene-2,8-dione |
|---|---|
| PubChem CID | 74155535 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 5a-ethenyl-4-hydroxy-3-methyl-9-methylidene-3a,4,5,6,9a,9b-hexahydro-3H-furo[2,3-f]isochromene-2,8-dione |
| SMILES | C=CC12COC(=O)C(=C)C1C1OC(=O)C(C)C1C(O)C2 |
| InChI | InChI=1S/C15H18O5/c1-4-15-5-9(16)10-7(2)14(18)20-12(10)11(15)8(3)13(17)19-6-15/h4,7,9-12,16H,1,3,5-6H2,2H3 |
| InChIKey | WTCWDHQLVIQMJY-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|