C23H40N2OSi — CID 23241586
(4S)-4-[tert-butyl(dimethyl)silyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1-phenylpentan-3-imine (PubChem CID 23241586) has the molecular formula C23H40N2OSi and a molecular weight of 388.67 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(dimethyl)silyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1-phenylpentan-3-imine.
| Compound Name | (4S)-4-[tert-butyl(dimethyl)silyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1-phenylpentan-3-imine |
|---|---|
| PubChem CID | 23241586 |
| Molecular Formula | C23H40N2OSi |
| Molecular Weight | 388.67 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | (4S)-4-[tert-butyl(dimethyl)silyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1-phenylpentan-3-imine |
| SMILES | COC[C@@H]1CCCN1N=C(CCc1ccccc1)[C@H](C)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H40N2OSi/c1-19(27(6,7)23(2,3)4)22(16-15-20-12-9-8-10-13-20)24-25-17-11-14-21(25)18-26-5/h8-10,12-13,19,21H,11,14-18H2,1-7H3/t19-,21-/m0/s1 |
| InChIKey | JODPWODFPYENMZ-FPOVZHCZSA-N |
| XLogP | 5.98 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.67 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|