C9H18O3 — CID 23244381
(3R,4S)-3,7,7-trimethyloxepane-3,4-diol (PubChem CID 23244381) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is (3R,4S)-3,7,7-trimethyloxepane-3,4-diol.
| Compound Name | (3R,4S)-3,7,7-trimethyloxepane-3,4-diol |
|---|---|
| PubChem CID | 23244381 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | (3R,4S)-3,7,7-trimethyloxepane-3,4-diol |
| SMILES | CC1(C)CC[C@H](O)[C@](C)(O)CO1 |
| InChI | InChI=1S/C9H18O3/c1-8(2)5-4-7(10)9(3,11)6-12-8/h7,10-11H,4-6H2,1-3H3/t7-,9+/m0/s1 |
| InChIKey | OLSAWKMNBFWTAC-IONNQARKSA-N |
| XLogP | 0.69 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |