C17H26N4O6 — CID 23245054
dimethyl (2S)-2-[4-[(2S)-3-(1H-imidazol-5-yl)-1-methoxy-1-oxopropan-2-yl]piperazin-1-yl]butanedioate (PubChem CID 23245054) has the molecular formula C17H26N4O6 and a molecular weight of 382.42 g/mol. Its IUPAC name is dimethyl (2S)-2-[4-[(2S)-3-(1H-imidazol-5-yl)-1-methoxy-1-oxopropan-2-yl]piperazin-1-yl]butanedioate.
| Compound Name | dimethyl (2S)-2-[4-[(2S)-3-(1H-imidazol-5-yl)-1-methoxy-1-oxopropan-2-yl]piperazin-1-yl]butanedioate |
|---|---|
| PubChem CID | 23245054 |
| Molecular Formula | C17H26N4O6 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | dimethyl (2S)-2-[4-[(2S)-3-(1H-imidazol-5-yl)-1-methoxy-1-oxopropan-2-yl]piperazin-1-yl]butanedioate |
| SMILES | COC(=O)C[C@@H](C(=O)OC)N1CCN([C@@H](Cc2cnc[nH]2)C(=O)OC)CC1 |
| InChI | InChI=1S/C17H26N4O6/c1-25-15(22)9-14(17(24)27-3)21-6-4-20(5-7-21)13(16(23)26-2)8-12-10-18-11-19-12/h10-11,13-14H,4-9H2,1-3H3,(H,18,19)/t13-,14-/m0/s1 |
| InChIKey | CKGDHRNPSYJEBD-KBPBESRZSA-N |
| XLogP | -0.78 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|