C8H9N3O3 — CID 174342362
methyl 3-(1H-imidazol-5-yl)-2-isocyanatopropanoate (PubChem CID 174342362) has the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. Its IUPAC name is methyl 3-(1H-imidazol-5-yl)-2-isocyanatopropanoate.
| Compound Name | methyl 3-(1H-imidazol-5-yl)-2-isocyanatopropanoate |
|---|---|
| PubChem CID | 174342362 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | methyl 3-(1H-imidazol-5-yl)-2-isocyanatopropanoate |
| SMILES | COC(=O)C(Cc1cnc[nH]1)N=C=O |
| InChI | InChI=1S/C8H9N3O3/c1-14-8(13)7(11-5-12)2-6-3-9-4-10-6/h3-4,7H,2H2,1H3,(H,9,10) |
| InChIKey | CNPOKTOGOVRZQB-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 84.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|