C19H15N3OS2 — CID 2324546
N-(4,5-dihydrobenzo[e][1,3]benzothiazol-2-ylcarbamothioyl)benzamide (PubChem CID 2324546) has the molecular formula C19H15N3OS2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-(4,5-dihydrobenzo[e][1,3]benzothiazol-2-ylcarbamothioyl)benzamide.
| Compound Name | N-(4,5-dihydrobenzo[e][1,3]benzothiazol-2-ylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 2324546 |
| Molecular Formula | C19H15N3OS2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-(4,5-dihydrobenzo[e][1,3]benzothiazol-2-ylcarbamothioyl)benzamide |
| SMILES | O=C(NC(=S)Nc1nc2c(s1)CCc1ccccc1-2)c1ccccc1 |
| InChI | InChI=1S/C19H15N3OS2/c23-17(13-7-2-1-3-8-13)21-18(24)22-19-20-16-14-9-5-4-6-12(14)10-11-15(16)25-19/h1-9H,10-11H2,(H2,20,21,22,23,24) |
| InChIKey | AXDPTHVYKJWFKV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|