C22H24NO3+ — CID 23245665
1-[1-methyl-3,4-bis(phenylmethoxy)pyridin-1-ium-2-yl]ethanol (PubChem CID 23245665) has the molecular formula C22H24NO3+ and a molecular weight of 350.44 g/mol. Its IUPAC name is 1-[1-methyl-3,4-bis(phenylmethoxy)pyridin-1-ium-2-yl]ethanol.
| Compound Name | 1-[1-methyl-3,4-bis(phenylmethoxy)pyridin-1-ium-2-yl]ethanol |
|---|---|
| PubChem CID | 23245665 |
| Molecular Formula | C22H24NO3+ |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 1-[1-methyl-3,4-bis(phenylmethoxy)pyridin-1-ium-2-yl]ethanol |
| SMILES | CC(O)c1c(OCc2ccccc2)c(OCc2ccccc2)cc[n+]1C |
| InChI | InChI=1S/C22H24NO3/c1-17(24)21-22(26-16-19-11-7-4-8-12-19)20(13-14-23(21)2)25-15-18-9-5-3-6-10-18/h3-14,17,24H,15-16H2,1-2H3/q+1 |
| InChIKey | WJGBNDZNFHAEJJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|