C14H16NO2+ — CID 152985239
1-hydroxy-2,3-dimethyl-4-phenylmethoxypyridin-1-ium (PubChem CID 152985239) has the molecular formula C14H16NO2+ and a molecular weight of 230.29 g/mol. Its IUPAC name is 1-hydroxy-2,3-dimethyl-4-phenylmethoxypyridin-1-ium.
| Compound Name | 1-hydroxy-2,3-dimethyl-4-phenylmethoxypyridin-1-ium |
|---|---|
| PubChem CID | 152985239 |
| Molecular Formula | C14H16NO2+ |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1-hydroxy-2,3-dimethyl-4-phenylmethoxypyridin-1-ium |
| SMILES | Cc1c(OCc2ccccc2)cc[n+](O)c1C |
| InChI | InChI=1S/C14H16NO2/c1-11-12(2)15(16)9-8-14(11)17-10-13-6-4-3-5-7-13/h3-9,16H,10H2,1-2H3/q+1 |
| InChIKey | JPFNBSSTZSFDJQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 33.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|