C14H25NO5S — CID 23245842
4-methyl-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylsulfanyl]pentanoic acid (PubChem CID 23245842) has the molecular formula C14H25NO5S and a molecular weight of 319.42 g/mol. Its IUPAC name is 4-methyl-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylsulfanyl]pentanoic acid.
| Compound Name | 4-methyl-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylsulfanyl]pentanoic acid |
|---|---|
| PubChem CID | 23245842 |
| Molecular Formula | C14H25NO5S |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 4-methyl-2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoylsulfanyl]pentanoic acid |
| SMILES | CC(C)CC(SC(=O)CCNC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H25NO5S/c1-9(2)8-10(12(17)18)21-11(16)6-7-15-13(19)20-14(3,4)5/h9-10H,6-8H2,1-5H3,(H,15,19)(H,17,18) |
| InChIKey | VUALENQUXJYMBK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|