C11H11F3N2O3S — CID 23247006
[7-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]methyl methanesulfonate (PubChem CID 23247006) has the molecular formula C11H11F3N2O3S and a molecular weight of 308.28 g/mol. Its IUPAC name is [7-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]methyl methanesulfonate.
| Compound Name | [7-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 23247006 |
| Molecular Formula | C11H11F3N2O3S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | [7-methyl-2-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl]methyl methanesulfonate |
| SMILES | Cc1ccn2c(COS(C)(=O)=O)c(C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C11H11F3N2O3S/c1-7-3-4-16-8(6-19-20(2,17)18)10(11(12,13)14)15-9(16)5-7/h3-5H,6H2,1-2H3 |
| InChIKey | SPVUXAUZSGGMBD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|