C21H42O4 — CID 23247336
methyl (3S,4S,6S,10S)-4,6,10-triethyl-3,6-dihydroxytetradecanoate (PubChem CID 23247336) has the molecular formula C21H42O4 and a molecular weight of 358.56 g/mol. Its IUPAC name is methyl (3S,4S,6S,10S)-4,6,10-triethyl-3,6-dihydroxytetradecanoate.
| Compound Name | methyl (3S,4S,6S,10S)-4,6,10-triethyl-3,6-dihydroxytetradecanoate |
|---|---|
| PubChem CID | 23247336 |
| Molecular Formula | C21H42O4 |
| Molecular Weight | 358.56 g/mol |
| Exact Mass | 358.31 |
| IUPAC Name | methyl (3S,4S,6S,10S)-4,6,10-triethyl-3,6-dihydroxytetradecanoate |
| SMILES | CCCC[C@H](CC)CCC[C@@](O)(CC)C[C@H](CC)[C@@H](O)CC(=O)OC |
| InChI | InChI=1S/C21H42O4/c1-6-10-12-17(7-2)13-11-14-21(24,9-4)16-18(8-3)19(22)15-20(23)25-5/h17-19,22,24H,6-16H2,1-5H3/t17-,18-,19-,21-/m0/s1 |
| InChIKey | PLLYKLHTYUIDHJ-IWFBPKFRSA-N |
| XLogP | 4.85 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |