C18H35ClO4 — CID 45112621
methyl (3R,4R,6S,8S)-8-[(1R)-1-chloroethyl]-4-ethyl-3,6-dihydroxy-6-methyldodecanoate (PubChem CID 45112621) has the molecular formula C18H35ClO4 and a molecular weight of 350.93 g/mol. Its IUPAC name is methyl (3R,4R,6S,8S)-8-[(1R)-1-chloroethyl]-4-ethyl-3,6-dihydroxy-6-methyldodecanoate.
| Compound Name | methyl (3R,4R,6S,8S)-8-[(1R)-1-chloroethyl]-4-ethyl-3,6-dihydroxy-6-methyldodecanoate |
|---|---|
| PubChem CID | 45112621 |
| Molecular Formula | C18H35ClO4 |
| Molecular Weight | 350.93 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | methyl (3R,4R,6S,8S)-8-[(1R)-1-chloroethyl]-4-ethyl-3,6-dihydroxy-6-methyldodecanoate |
| SMILES | CCCC[C@@H](C[C@@](C)(O)C[C@@H](CC)[C@H](O)CC(=O)OC)[C@@H](C)Cl |
| InChI | InChI=1S/C18H35ClO4/c1-6-8-9-15(13(3)19)12-18(4,22)11-14(7-2)16(20)10-17(21)23-5/h13-16,20,22H,6-12H2,1-5H3/t13-,14-,15+,16-,18+/m1/s1 |
| InChIKey | CQJABTZRNDRLMJ-QFXBJFAPSA-N |
| XLogP | 3.90 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.93 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|