C29H28O9 — CID 23247903
[(2R,3R,4R,5S,6R)-3,4-dibenzoyloxy-5-hydroxy-6-[(1R)-1-hydroxyethyl]oxan-2-yl]methyl benzoate (PubChem CID 23247903) has the molecular formula C29H28O9 and a molecular weight of 520.53 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-3,4-dibenzoyloxy-5-hydroxy-6-[(1R)-1-hydroxyethyl]oxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4R,5S,6R)-3,4-dibenzoyloxy-5-hydroxy-6-[(1R)-1-hydroxyethyl]oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 23247903 |
| Molecular Formula | C29H28O9 |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-3,4-dibenzoyloxy-5-hydroxy-6-[(1R)-1-hydroxyethyl]oxan-2-yl]methyl benzoate |
| SMILES | C[C@@H](O)[C@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C29H28O9/c1-18(30)24-23(31)26(38-29(34)21-15-9-4-10-16-21)25(37-28(33)20-13-7-3-8-14-20)22(36-24)17-35-27(32)19-11-5-2-6-12-19/h2-16,18,22-26,30-31H,17H2,1H3/t18-,22-,23+,24-,25-,26-/m1/s1 |
| InChIKey | IMGYFVUPMBXCFF-KWFIBPEBSA-N |
| XLogP | 2.80 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|