C15H22N2O10 — CID 23248620
diethyl 2-[[(1,3-diethoxy-1,3-dioxopropan-2-ylidene)amino]oxymethoxyimino]propanedioate (PubChem CID 23248620) has the molecular formula C15H22N2O10 and a molecular weight of 390.35 g/mol. Its IUPAC name is diethyl 2-[[(1,3-diethoxy-1,3-dioxopropan-2-ylidene)amino]oxymethoxyimino]propanedioate.
| Compound Name | diethyl 2-[[(1,3-diethoxy-1,3-dioxopropan-2-ylidene)amino]oxymethoxyimino]propanedioate |
|---|---|
| PubChem CID | 23248620 |
| Molecular Formula | C15H22N2O10 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | diethyl 2-[[(1,3-diethoxy-1,3-dioxopropan-2-ylidene)amino]oxymethoxyimino]propanedioate |
| SMILES | CCOC(=O)C(=NOCON=C(C(=O)OCC)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C15H22N2O10/c1-5-22-12(18)10(13(19)23-6-2)16-26-9-27-17-11(14(20)24-7-3)15(21)25-8-4/h5-9H2,1-4H3 |
| InChIKey | TXSLCOBZNOTVAO-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 148.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|