C22H30O15 — CID 23249913
methyl (2S,4R,5S,6S)-2,4,5-triacetyloxy-6-[(1S,2S)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 23249913) has the molecular formula C22H30O15 and a molecular weight of 534.47 g/mol. Its IUPAC name is methyl (2S,4R,5S,6S)-2,4,5-triacetyloxy-6-[(1S,2S)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,4R,5S,6S)-2,4,5-triacetyloxy-6-[(1S,2S)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 23249913 |
| Molecular Formula | C22H30O15 |
| Molecular Weight | 534.47 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | methyl (2S,4R,5S,6S)-2,4,5-triacetyloxy-6-[(1S,2S)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(OC(C)=O)C[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]([C@@H](OC(C)=O)[C@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C22H30O15/c1-10(23)31-9-17(33-12(3)25)19(35-14(5)27)20-18(34-13(4)26)16(32-11(2)24)8-22(37-20,21(29)30-7)36-15(6)28/h16-20H,8-9H2,1-7H3/t16-,17+,18+,19+,20+,22-/m1/s1 |
| InChIKey | CDJOMBIWROBESK-AGMHDLFCSA-N |
| XLogP | -0.50 |
| TPSA | 193.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.47 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|