C17H32O5Si — CID 23253300
methyl (2R)-2-[(2S,3R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-5-oxooxan-2-yl]propanoate (PubChem CID 23253300) has the molecular formula C17H32O5Si and a molecular weight of 344.52 g/mol. Its IUPAC name is methyl (2R)-2-[(2S,3R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-5-oxooxan-2-yl]propanoate.
| Compound Name | methyl (2R)-2-[(2S,3R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-5-oxooxan-2-yl]propanoate |
|---|---|
| PubChem CID | 23253300 |
| Molecular Formula | C17H32O5Si |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | methyl (2R)-2-[(2S,3R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-methyl-5-oxooxan-2-yl]propanoate |
| SMILES | COC(=O)[C@H](C)[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)C(=O)C[C@H]1C |
| InChI | InChI=1S/C17H32O5Si/c1-11-9-13(18)14(10-21-23(7,8)17(3,4)5)22-15(11)12(2)16(19)20-6/h11-12,14-15H,9-10H2,1-8H3/t11-,12-,14-,15+/m1/s1 |
| InChIKey | WFCBSRFRJLCKIA-GBOPCIDUSA-N |
| XLogP | 3.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|