C12H24O5Si — CID 23255675
(2R,3S,4S)-2-(hydroxymethyl)-4-(2-trimethylsilylethoxymethoxy)-3,4-dihydro-2H-pyran-3-ol (PubChem CID 23255675) has the molecular formula C12H24O5Si and a molecular weight of 276.41 g/mol. Its IUPAC name is (2R,3S,4S)-2-(hydroxymethyl)-4-(2-trimethylsilylethoxymethoxy)-3,4-dihydro-2H-pyran-3-ol.
| Compound Name | (2R,3S,4S)-2-(hydroxymethyl)-4-(2-trimethylsilylethoxymethoxy)-3,4-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 23255675 |
| Molecular Formula | C12H24O5Si |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (2R,3S,4S)-2-(hydroxymethyl)-4-(2-trimethylsilylethoxymethoxy)-3,4-dihydro-2H-pyran-3-ol |
| SMILES | C[Si](C)(C)CCOCO[C@H]1C=CO[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C12H24O5Si/c1-18(2,3)7-6-15-9-17-10-4-5-16-11(8-13)12(10)14/h4-5,10-14H,6-9H2,1-3H3/t10-,11+,12-/m0/s1 |
| InChIKey | QGTQKHNNYHZYPK-TUAOUCFPSA-N |
| XLogP | 0.95 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|