C6H9N3O2 — CID 23256083
(3R,5S)-5-(azidomethyl)-3-methyloxolan-2-one (PubChem CID 23256083) has the molecular formula C6H9N3O2 and a molecular weight of 155.16 g/mol. Its IUPAC name is (3R,5S)-5-(azidomethyl)-3-methyloxolan-2-one.
| Compound Name | (3R,5S)-5-(azidomethyl)-3-methyloxolan-2-one |
|---|---|
| PubChem CID | 23256083 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | (3R,5S)-5-(azidomethyl)-3-methyloxolan-2-one |
| SMILES | C[C@@H]1C[C@@H](CN=[N+]=[N-])OC1=O |
| InChI | InChI=1S/C6H9N3O2/c1-4-2-5(3-8-9-7)11-6(4)10/h4-5H,2-3H2,1H3/t4-,5+/m1/s1 |
| InChIKey | HWTOFXWZDDBLCN-UHNVWZDZSA-N |
| XLogP | 1.25 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|