C32H42O6 — CID 23256289
[2-[4-(4-methoxyphenyl)butanoyloxy]-3-phenylmethoxypropyl] undec-10-ynoate (PubChem CID 23256289) has the molecular formula C32H42O6 and a molecular weight of 522.68 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)butanoyloxy]-3-phenylmethoxypropyl] undec-10-ynoate.
| Compound Name | [2-[4-(4-methoxyphenyl)butanoyloxy]-3-phenylmethoxypropyl] undec-10-ynoate |
|---|---|
| PubChem CID | 23256289 |
| Molecular Formula | C32H42O6 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)butanoyloxy]-3-phenylmethoxypropyl] undec-10-ynoate |
| SMILES | C#CCCCCCCCCC(=O)OCC(COCc1ccccc1)OC(=O)CCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C32H42O6/c1-3-4-5-6-7-8-9-13-18-31(33)37-26-30(25-36-24-28-15-11-10-12-16-28)38-32(34)19-14-17-27-20-22-29(35-2)23-21-27/h1,10-12,15-16,20-23,30H,4-9,13-14,17-19,24-26H2,2H3 |
| InChIKey | BRIYCBKCFIMCMV-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|