C15H14ClN5O — CID 23256697
3-[(8-chloro-2-phenylpyrimido[4,5-d]pyridazin-5-yl)amino]propan-1-ol (PubChem CID 23256697) has the molecular formula C15H14ClN5O and a molecular weight of 315.76 g/mol. Its IUPAC name is 3-[(8-chloro-2-phenylpyrimido[4,5-d]pyridazin-5-yl)amino]propan-1-ol.
| Compound Name | 3-[(8-chloro-2-phenylpyrimido[4,5-d]pyridazin-5-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 23256697 |
| Molecular Formula | C15H14ClN5O |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 3-[(8-chloro-2-phenylpyrimido[4,5-d]pyridazin-5-yl)amino]propan-1-ol |
| SMILES | OCCCNc1nnc(Cl)c2nc(-c3ccccc3)ncc12 |
| InChI | InChI=1S/C15H14ClN5O/c16-13-12-11(15(21-20-13)17-7-4-8-22)9-18-14(19-12)10-5-2-1-3-6-10/h1-3,5-6,9,22H,4,7-8H2,(H,17,21) |
| InChIKey | QVFPIUDUSAWWNZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|