C18H17N5O4S — CID 2326128
2-[[5-(2-nitrophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenoxyethyl)acetamide (PubChem CID 2326128) has the molecular formula C18H17N5O4S and a molecular weight of 399.43 g/mol. Its IUPAC name is 2-[[5-(2-nitrophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-[[5-(2-nitrophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 2326128 |
| Molecular Formula | C18H17N5O4S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 2-[[5-(2-nitrophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-N-(2-phenoxyethyl)acetamide |
| SMILES | O=C(CSc1n[nH]c(-c2ccccc2[N+](=O)[O-])n1)NCCOc1ccccc1 |
| InChI | InChI=1S/C18H17N5O4S/c24-16(19-10-11-27-13-6-2-1-3-7-13)12-28-18-20-17(21-22-18)14-8-4-5-9-15(14)23(25)26/h1-9H,10-12H2,(H,19,24)(H,20,21,22) |
| InChIKey | IXSFGSSADHURKR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|