C18H26N2O2Si2 — CID 23261899
[(Z)-1,2-dipyridin-3-yl-2-trimethylsilyloxyethenoxy]-trimethylsilane (PubChem CID 23261899) has the molecular formula C18H26N2O2Si2 and a molecular weight of 358.59 g/mol. Its IUPAC name is [(Z)-1,2-dipyridin-3-yl-2-trimethylsilyloxyethenoxy]-trimethylsilane.
| Compound Name | [(Z)-1,2-dipyridin-3-yl-2-trimethylsilyloxyethenoxy]-trimethylsilane |
|---|---|
| PubChem CID | 23261899 |
| Molecular Formula | C18H26N2O2Si2 |
| Molecular Weight | 358.59 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [(Z)-1,2-dipyridin-3-yl-2-trimethylsilyloxyethenoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)O/C(=C(\O[Si](C)(C)C)c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C18H26N2O2Si2/c1-23(2,3)21-17(15-9-7-11-19-13-15)18(22-24(4,5)6)16-10-8-12-20-14-16/h7-14H,1-6H3/b18-17- |
| InChIKey | QYZKNFQCBLMHHX-ZCXUNETKSA-N |
| XLogP | 5.01 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|