About CID 23262250
CID 23262250 (PubChem CID 23262250) has the molecular formula C2H5GeI2
and a molecular weight of 355.48 g/mol.
Molecular Properties
| Compound Name | CID 23262250 |
| PubChem CID | 23262250 |
| Molecular Formula | C2H5GeI2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 356.77 |
| IUPAC Name | — |
| SMILES | CC[Ge](I)I |
| InChI | InChI=1S/C2H5GeI2/c1-2-3(4)5/h2H2,1H3 |
| InChIKey | HSRIUIYANZMHLY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 23262250 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23262250?
The IUPAC name of CID 23262250 (CID 23262250) is not available.
What is the SMILES notation for CID 23262250?
The canonical SMILES for CID 23262250 is CC[Ge](I)I.
What is the InChIKey of CID 23262250?
The InChIKey is HSRIUIYANZMHLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5GeI2/c1-2-3(4)5/h2H2,1H3.
What are the key properties of CID 23262250?
CID 23262250 has a molecular weight of 355.48 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23262250 is sourced from PubChem (CID 23262250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).