About CID 173141980
CID 173141980 (PubChem CID 173141980) has the molecular formula C5H14BrGe
and a molecular weight of 226.68 g/mol.
Molecular Properties
| Compound Name | CID 173141980 |
| PubChem CID | 173141980 |
| Molecular Formula | C5H14BrGe |
| Molecular Weight | 226.68 g/mol |
| Exact Mass | 226.95 |
| IUPAC Name | — |
| SMILES | Br.CC[Ge](C)CC |
| InChI | InChI=1S/C5H13Ge.BrH/c1-4-6(3)5-2;/h4-5H2,1-3H3;1H |
| InChIKey | FIGZKHMLTFWHGE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.68 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 173141980 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173141980?
The IUPAC name of CID 173141980 (CID 173141980) is not available.
What is the SMILES notation for CID 173141980?
The canonical SMILES for CID 173141980 is Br.CC[Ge](C)CC.
What is the InChIKey of CID 173141980?
The InChIKey is FIGZKHMLTFWHGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13Ge.BrH/c1-4-6(3)5-2;/h4-5H2,1-3H3;1H.
What are the key properties of CID 173141980?
CID 173141980 has a molecular weight of 226.68 g/mol, XLogP of 2.73, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173141980 is sourced from PubChem (CID 173141980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).