C23H32N6O — CID 23263071
1,3-bis[5-(1-methylpiperidin-2-yl)-2-pyridinyl]urea (PubChem CID 23263071) has the molecular formula C23H32N6O and a molecular weight of 408.55 g/mol. Its IUPAC name is 1,3-bis[5-(1-methylpiperidin-2-yl)-2-pyridinyl]urea.
| Compound Name | 1,3-bis[5-(1-methylpiperidin-2-yl)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 23263071 |
| Molecular Formula | C23H32N6O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 1,3-bis[5-(1-methylpiperidin-2-yl)-2-pyridinyl]urea |
| SMILES | CN1CCCCC1c1ccc(NC(=O)Nc2ccc(C3CCCCN3C)cn2)nc1 |
| InChI | InChI=1S/C23H32N6O/c1-28-13-5-3-7-19(28)17-9-11-21(24-15-17)26-23(30)27-22-12-10-18(16-25-22)20-8-4-6-14-29(20)2/h9-12,15-16,19-20H,3-8,13-14H2,1-2H3,(H2,24,25,26,27,30) |
| InChIKey | RYASRGTYSJOHEA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |