C15H20O5S — CID 23263116
(1R,2S,3S,4R,5S)-2-methyl-4-[(4-methylphenyl)sulfonylmethyl]-6,8-dioxabicyclo[3.2.1]octan-3-ol (PubChem CID 23263116) has the molecular formula C15H20O5S and a molecular weight of 312.39 g/mol. Its IUPAC name is (1R,2S,3S,4R,5S)-2-methyl-4-[(4-methylphenyl)sulfonylmethyl]-6,8-dioxabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1R,2S,3S,4R,5S)-2-methyl-4-[(4-methylphenyl)sulfonylmethyl]-6,8-dioxabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 23263116 |
| Molecular Formula | C15H20O5S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (1R,2S,3S,4R,5S)-2-methyl-4-[(4-methylphenyl)sulfonylmethyl]-6,8-dioxabicyclo[3.2.1]octan-3-ol |
| SMILES | Cc1ccc(S(=O)(=O)C[C@H]2[C@H]3OC[C@H](O3)[C@@H](C)[C@@H]2O)cc1 |
| InChI | InChI=1S/C15H20O5S/c1-9-3-5-11(6-4-9)21(17,18)8-12-14(16)10(2)13-7-19-15(12)20-13/h3-6,10,12-16H,7-8H2,1-2H3/t10-,12-,13+,14+,15+/m1/s1 |
| InChIKey | ZIMVCCMEAQZZHM-IKSZGEOFSA-N |
| XLogP | 1.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |