C16H17NO2 — CID 23264164
methyl 2-methoxy-N,2-diphenylethanimidate (PubChem CID 23264164) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is methyl 2-methoxy-N,2-diphenylethanimidate.
| Compound Name | methyl 2-methoxy-N,2-diphenylethanimidate |
|---|---|
| PubChem CID | 23264164 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | methyl 2-methoxy-N,2-diphenylethanimidate |
| SMILES | CO/C(=N\c1ccccc1)C(OC)c1ccccc1 |
| InChI | InChI=1S/C16H17NO2/c1-18-15(13-9-5-3-6-10-13)16(19-2)17-14-11-7-4-8-12-14/h3-12,15H,1-2H3/b17-16- |
| InChIKey | JXFGTUGMZUSTJC-MSUUIHNZSA-N |
| XLogP | 3.75 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|