C12H16O3 — CID 57260111
[(E)-1,2,3-trimethoxyprop-2-enyl]benzene (PubChem CID 57260111) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is [(E)-1,2,3-trimethoxyprop-2-enyl]benzene.
| Compound Name | [(E)-1,2,3-trimethoxyprop-2-enyl]benzene |
|---|---|
| PubChem CID | 57260111 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | [(E)-1,2,3-trimethoxyprop-2-enyl]benzene |
| SMILES | CO/C=C(/OC)C(OC)c1ccccc1 |
| InChI | InChI=1S/C12H16O3/c1-13-9-11(14-2)12(15-3)10-7-5-4-6-8-10/h4-9,12H,1-3H3/b11-9+ |
| InChIKey | AOURZGSUPNAYBI-PKNBQFBNSA-N |
| XLogP | 2.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|