About (4S)-4-[(2S)-butan-2-yl]-2-methyl-4H-1,3-oxazol-5-one
(4S)-4-[(2S)-butan-2-yl]-2-methyl-4H-1,3-oxazol-5-one (PubChem CID 23266298) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is (4S)-4-[(2S)-butan-2-yl]-2-methyl-4H-1,3-oxazol-5-one.
Analyze (4S)-4-[(2S)-butan-2-yl]-2-methyl-4H-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-[(2S)-butan-2-yl]-2-methyl-4H-1,3-oxazol-5-one?
The IUPAC name of (4S)-4-[(2S)-butan-2-yl]-2-methyl-4H-1,3-oxazol-5-one (CID 23266298) is (4S)-4-[(2S)-butan-2-yl]-2-methyl-4H-1,3-oxazol-5-one.
What is the SMILES notation for (4S)-4-[(2S)-butan-2-yl]-2-methyl-4H-1,3-oxazol-5-one?
The canonical SMILES for (4S)-4-[(2S)-butan-2-yl]-2-methyl-4H-1,3-oxazol-5-one is CC[C@H](C)[C@@H]1N=C(C)OC1=O.
What is the InChIKey of (4S)-4-[(2S)-butan-2-yl]-2-methyl-4H-1,3-oxazol-5-one?
The InChIKey is QAWLHLFONLWAQG-FSPLSTOPSA-N. The full InChI is InChI=1S/C8H13NO2/c1-4-5(2)7-8(10)11-6(3)9-7/h5,7H,4H2,1-3H3/t5-,7-/m0/s1.
What are the key properties of (4S)-4-[(2S)-butan-2-yl]-2-methyl-4H-1,3-oxazol-5-one?
(4S)-4-[(2S)-butan-2-yl]-2-methyl-4H-1,3-oxazol-5-one has a molecular weight of 155.20 g/mol, XLogP of 1.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-[(2S)-butan-2-yl]-2-methyl-4H-1,3-oxazol-5-one is sourced from PubChem (CID 23266298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).