C8H10F3NO2 — CID 131853171
4-butan-2-yl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one (PubChem CID 131853171) has the molecular formula C8H10F3NO2 and a molecular weight of 209.17 g/mol. Its IUPAC name is 4-butan-2-yl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one.
| Compound Name | 4-butan-2-yl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 131853171 |
| Molecular Formula | C8H10F3NO2 |
| Molecular Weight | 209.17 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 4-butan-2-yl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one |
| SMILES | CCC(C)C1N=C(C(F)(F)F)OC1=O |
| InChI | InChI=1S/C8H10F3NO2/c1-3-4(2)5-6(13)14-7(12-5)8(9,10)11/h4-5H,3H2,1-2H3 |
| InChIKey | GUBKWFREOLBEKU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.17 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |