About 4-propan-2-yl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one
4-propan-2-yl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one (PubChem CID 86159330) has the molecular formula C7H8F3NO2
and a molecular weight of 195.14 g/mol. Its IUPAC name is 4-propan-2-yl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one.
Analyze 4-propan-2-yl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one?
The IUPAC name of 4-propan-2-yl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one (CID 86159330) is 4-propan-2-yl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one.
What is the SMILES notation for 4-propan-2-yl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one?
The canonical SMILES for 4-propan-2-yl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one is CC(C)C1N=C(C(F)(F)F)OC1=O.
What is the InChIKey of 4-propan-2-yl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one?
The InChIKey is JFOBWMWHWRWCPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3NO2/c1-3(2)4-5(12)13-6(11-4)7(8,9)10/h3-4H,1-2H3.
What are the key properties of 4-propan-2-yl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one?
4-propan-2-yl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one has a molecular weight of 195.14 g/mol, XLogP of 1.53, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-2-(trifluoromethyl)-4H-1,3-oxazol-5-one is sourced from PubChem (CID 86159330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).