C8H12F3NO2 — CID 118175703
methyl (2R)-3-methyl-2-(2,2,2-trifluoroethylideneamino)butanoate (PubChem CID 118175703) has the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. Its IUPAC name is methyl (2R)-3-methyl-2-(2,2,2-trifluoroethylideneamino)butanoate.
| Compound Name | methyl (2R)-3-methyl-2-(2,2,2-trifluoroethylideneamino)butanoate |
|---|---|
| PubChem CID | 118175703 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | methyl (2R)-3-methyl-2-(2,2,2-trifluoroethylideneamino)butanoate |
| SMILES | COC(=O)[C@H](/N=C/C(F)(F)F)C(C)C |
| InChI | InChI=1S/C8H12F3NO2/c1-5(2)6(7(13)14-3)12-4-8(9,10)11/h4-6H,1-3H3/b12-4+/t6-/m1/s1 |
| InChIKey | DBSTVOYFFBWIAF-YZXZPUIHSA-N |
| XLogP | 1.82 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|