C9H14F3NO2 — CID 122203370
methyl (2S,3S)-3-methyl-2-(2,2,2-trifluoroethylideneamino)pentanoate (PubChem CID 122203370) has the molecular formula C9H14F3NO2 and a molecular weight of 225.21 g/mol. Its IUPAC name is methyl (2S,3S)-3-methyl-2-(2,2,2-trifluoroethylideneamino)pentanoate.
| Compound Name | methyl (2S,3S)-3-methyl-2-(2,2,2-trifluoroethylideneamino)pentanoate |
|---|---|
| PubChem CID | 122203370 |
| Molecular Formula | C9H14F3NO2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | methyl (2S,3S)-3-methyl-2-(2,2,2-trifluoroethylideneamino)pentanoate |
| SMILES | CC[C@H](C)[C@H](/N=C/C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C9H14F3NO2/c1-4-6(2)7(8(14)15-3)13-5-9(10,11)12/h5-7H,4H2,1-3H3/b13-5+/t6-,7-/m0/s1 |
| InChIKey | HKSXBOUYXRYTEK-PRAXHIMJSA-N |
| XLogP | 2.21 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|