C7H11NO2 — CID 14038106
(4R)-2-methyl-4-propan-2-yl-4H-1,3-oxazol-5-one (PubChem CID 14038106) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is (4R)-2-methyl-4-propan-2-yl-4H-1,3-oxazol-5-one.
| Compound Name | (4R)-2-methyl-4-propan-2-yl-4H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 14038106 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (4R)-2-methyl-4-propan-2-yl-4H-1,3-oxazol-5-one |
| SMILES | CC1=N[C@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C7H11NO2/c1-4(2)6-7(9)10-5(3)8-6/h4,6H,1-3H3/t6-/m1/s1 |
| InChIKey | VSYHWTNTZROWMJ-ZCFIWIBFSA-N |
| XLogP | 0.99 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |