C21H26O5 — CID 23266962
[(4S,5S,10R,13S)-5-hydroxy-10,13-dimethyl-1,17-dioxo-4,6,7,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-4-yl] acetate (PubChem CID 23266962) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is [(4S,5S,10R,13S)-5-hydroxy-10,13-dimethyl-1,17-dioxo-4,6,7,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-4-yl] acetate.
| Compound Name | [(4S,5S,10R,13S)-5-hydroxy-10,13-dimethyl-1,17-dioxo-4,6,7,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-4-yl] acetate |
|---|---|
| PubChem CID | 23266962 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | [(4S,5S,10R,13S)-5-hydroxy-10,13-dimethyl-1,17-dioxo-4,6,7,9,11,12,15,16-octahydrocyclopenta[a]phenanthren-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=CC(=O)[C@]2(C)C3CC[C@]4(C)C(=O)CCC4=C3CC[C@@]12O |
| InChI | InChI=1S/C21H26O5/c1-12(22)26-18-7-6-17(24)20(3)15-9-10-19(2)14(4-5-16(19)23)13(15)8-11-21(18,20)25/h6-7,15,18,25H,4-5,8-11H2,1-3H3/t15?,18-,19-,20-,21+/m0/s1 |
| InChIKey | DCGJIJDVLYORMW-KGZQWFCHSA-N |
| XLogP | 2.66 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|