C32H44O10 — CID 162960767
[6-acetyloxy-15-[1-hydroxy-1-(4-hydroxy-4,5-dimethyl-6-oxooxan-2-yl)ethyl]-2,16-dimethyl-3-oxo-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-4-en-14-yl] acetate (PubChem CID 162960767) has the molecular formula C32H44O10 and a molecular weight of 588.69 g/mol. Its IUPAC name is [6-acetyloxy-15-[1-hydroxy-1-(4-hydroxy-4,5-dimethyl-6-oxooxan-2-yl)ethyl]-2,16-dimethyl-3-oxo-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-4-en-14-yl] acetate.
| Compound Name | [6-acetyloxy-15-[1-hydroxy-1-(4-hydroxy-4,5-dimethyl-6-oxooxan-2-yl)ethyl]-2,16-dimethyl-3-oxo-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-4-en-14-yl] acetate |
|---|---|
| PubChem CID | 162960767 |
| Molecular Formula | C32H44O10 |
| Molecular Weight | 588.69 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | [6-acetyloxy-15-[1-hydroxy-1-(4-hydroxy-4,5-dimethyl-6-oxooxan-2-yl)ethyl]-2,16-dimethyl-3-oxo-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-4-en-14-yl] acetate |
| SMILES | CC(=O)OC1CC2C3CC4OC45C(OC(C)=O)C=CC(=O)C5(C)C3CCC2(C)C1C(C)(O)C1CC(C)(O)C(C)C(=O)O1 |
| InChI | InChI=1S/C32H44O10/c1-15-27(36)41-25(14-29(15,5)37)31(7,38)26-21(39-16(2)33)13-20-18-12-24-32(42-24)23(40-17(3)34)9-8-22(35)30(32,6)19(18)10-11-28(20,26)4/h8-9,15,18-21,23-26,37-38H,10-14H2,1-7H3 |
| InChIKey | CGFNRECPWASOKJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 148.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.69 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|