C22H30O4 — CID 23266991
ethyl 2-[(1E,3E,5E,7E)-9-hydroxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3-dimethyl-4-oxocyclohex-2-ene-1-carboxylate (PubChem CID 23266991) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is ethyl 2-[(1E,3E,5E,7E)-9-hydroxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3-dimethyl-4-oxocyclohex-2-ene-1-carboxylate.
| Compound Name | ethyl 2-[(1E,3E,5E,7E)-9-hydroxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3-dimethyl-4-oxocyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 23266991 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | ethyl 2-[(1E,3E,5E,7E)-9-hydroxy-3,7-dimethylnona-1,3,5,7-tetraenyl]-1,3-dimethyl-4-oxocyclohex-2-ene-1-carboxylate |
| SMILES | CCOC(=O)C1(C)CCC(=O)C(C)=C1/C=C/C(C)=C/C=C/C(C)=C/CO |
| InChI | InChI=1S/C22H30O4/c1-6-26-21(25)22(5)14-12-20(24)18(4)19(22)11-10-16(2)8-7-9-17(3)13-15-23/h7-11,13,23H,6,12,14-15H2,1-5H3/b9-7+,11-10+,16-8+,17-13+ |
| InChIKey | YDPIYEXHOVPRLD-BRMLSVPOSA-N |
| XLogP | 4.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|