C13H26N2O5P2S2 — CID 23268490
(1S,2R,6R,9R)-4-N,4-N,11-N,11-N-tetraethyl-4,11-bis(sulfanylidene)-3,5,7,10,12-pentaoxa-4λ5,11λ5-diphosphatricyclo[7.3.0.02,6]dodecane-4,11-diamine (PubChem CID 23268490) has the molecular formula C13H26N2O5P2S2 and a molecular weight of 416.44 g/mol. Its IUPAC name is (1S,2R,6R,9R)-4-N,4-N,11-N,11-N-tetraethyl-4,11-bis(sulfanylidene)-3,5,7,10,12-pentaoxa-4λ5,11λ5-diphosphatricyclo[7.3.0.02,6]dodecane-4,11-diamine.
| Compound Name | (1S,2R,6R,9R)-4-N,4-N,11-N,11-N-tetraethyl-4,11-bis(sulfanylidene)-3,5,7,10,12-pentaoxa-4λ5,11λ5-diphosphatricyclo[7.3.0.02,6]dodecane-4,11-diamine |
|---|---|
| PubChem CID | 23268490 |
| Molecular Formula | C13H26N2O5P2S2 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | (1S,2R,6R,9R)-4-N,4-N,11-N,11-N-tetraethyl-4,11-bis(sulfanylidene)-3,5,7,10,12-pentaoxa-4λ5,11λ5-diphosphatricyclo[7.3.0.02,6]dodecane-4,11-diamine |
| SMILES | CCN(CC)P1(=S)O[C@H]2OC[C@H]3OP(=S)(N(CC)CC)O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C13H26N2O5P2S2/c1-5-14(6-2)21(23)17-10-9-16-13-12(11(10)18-21)19-22(24,20-13)15(7-3)8-4/h10-13H,5-9H2,1-4H3/t10-,11+,12-,13-,21?,22?/m1/s1 |
| InChIKey | RNKGZOFTPIEIAY-FZELBTFFSA-N |
| XLogP | 2.67 |
| TPSA | 52.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|