C13H9N3 — CID 23270060
6-methyl-5,6,7-triazatetracyclo[6.5.2.04,15.011,14]pentadeca-1(13),2,4,7,9,11,14-heptaene (PubChem CID 23270060) has the molecular formula C13H9N3 and a molecular weight of 207.24 g/mol. Its IUPAC name is 6-methyl-5,6,7-triazatetracyclo[6.5.2.04,15.011,14]pentadeca-1(13),2,4,7,9,11,14-heptaene.
| Compound Name | 6-methyl-5,6,7-triazatetracyclo[6.5.2.04,15.011,14]pentadeca-1(13),2,4,7,9,11,14-heptaene |
|---|---|
| PubChem CID | 23270060 |
| Molecular Formula | C13H9N3 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 6-methyl-5,6,7-triazatetracyclo[6.5.2.04,15.011,14]pentadeca-1(13),2,4,7,9,11,14-heptaene |
| SMILES | Cn1nc2ccc3ccc4ccc(n1)c2c34 |
| InChI | InChI=1S/C13H9N3/c1-16-14-10-6-4-8-2-3-9-5-7-11(15-16)13(10)12(8)9/h2-7H,1H3 |
| InChIKey | UKEZCEHRDOLNMQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'naphth_amino_D(2)', 'substructure': 'N/A'} |
|---|