C8H9ClHgO2 — CID 23270318
chloro-[(1S,2S,3S,6S,7R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]mercury (PubChem CID 23270318) has the molecular formula C8H9ClHgO2 and a molecular weight of 373.20 g/mol. Its IUPAC name is chloro-[(1S,2S,3S,6S,7R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]mercury.
| Compound Name | chloro-[(1S,2S,3S,6S,7R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]mercury |
|---|---|
| PubChem CID | 23270318 |
| Molecular Formula | C8H9ClHgO2 |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | chloro-[(1S,2S,3S,6S,7R)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl]mercury |
| SMILES | O=C1O[C@H]2[C@@H]3C[C@@H](C[C@H]13)[C@@H]2[Hg]Cl |
| InChI | InChI=1S/C8H9O2.ClH.Hg/c9-8-6-2-4-1-5(6)7(3-4)10-8;;/h3-7H,1-2H2;1H;/q;;+1/p-1/t4-,5+,6-,7+;;/m0../s1 |
| InChIKey | MVCUEEOLEDIERX-GCOCBRNPSA-M |
| XLogP | 1.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|