C8H9FO2 — CID 45090620
2-fluoro-4-oxatricyclo[4.2.1.03,7]nonan-5-one (PubChem CID 45090620) has the molecular formula C8H9FO2 and a molecular weight of 156.16 g/mol. Its IUPAC name is 2-fluoro-4-oxatricyclo[4.2.1.03,7]nonan-5-one.
| Compound Name | 2-fluoro-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
|---|---|
| PubChem CID | 45090620 |
| Molecular Formula | C8H9FO2 |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 2-fluoro-4-oxatricyclo[4.2.1.03,7]nonan-5-one |
| SMILES | O=C1OC2C(F)C3CC1C2C3 |
| InChI | InChI=1S/C8H9FO2/c9-6-3-1-4-5(2-3)8(10)11-7(4)6/h3-7H,1-2H2 |
| InChIKey | YPIPJUNZEHYLTO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |