C8H9NO8P2 — CID 23271390
[2-(4-nitrophenyl)-1-phosphonoethenyl]phosphonic acid (PubChem CID 23271390) has the molecular formula C8H9NO8P2 and a molecular weight of 309.11 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-1-phosphonoethenyl]phosphonic acid.
| Compound Name | [2-(4-nitrophenyl)-1-phosphonoethenyl]phosphonic acid |
|---|---|
| PubChem CID | 23271390 |
| Molecular Formula | C8H9NO8P2 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | [2-(4-nitrophenyl)-1-phosphonoethenyl]phosphonic acid |
| SMILES | O=[N+]([O-])c1ccc(C=C(P(=O)(O)O)P(=O)(O)O)cc1 |
| InChI | InChI=1S/C8H9NO8P2/c10-9(11)7-3-1-6(2-4-7)5-8(18(12,13)14)19(15,16)17/h1-5H,(H2,12,13,14)(H2,15,16,17) |
| InChIKey | MYQJQCHMQMFIFN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 158.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|