C16H20O12 — CID 23271775
tetramethyl 2-(1,3-dimethoxy-1,3-dioxopropan-2-yl)prop-1-ene-1,1,3,3-tetracarboxylate (PubChem CID 23271775) has the molecular formula C16H20O12 and a molecular weight of 404.32 g/mol. Its IUPAC name is tetramethyl 2-(1,3-dimethoxy-1,3-dioxopropan-2-yl)prop-1-ene-1,1,3,3-tetracarboxylate.
| Compound Name | tetramethyl 2-(1,3-dimethoxy-1,3-dioxopropan-2-yl)prop-1-ene-1,1,3,3-tetracarboxylate |
|---|---|
| PubChem CID | 23271775 |
| Molecular Formula | C16H20O12 |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | tetramethyl 2-(1,3-dimethoxy-1,3-dioxopropan-2-yl)prop-1-ene-1,1,3,3-tetracarboxylate |
| SMILES | COC(=O)C(C(=O)OC)=C(C(C(=O)OC)C(=O)OC)C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C16H20O12/c1-23-11(17)8(12(18)24-2)7(9(13(19)25-3)14(20)26-4)10(15(21)27-5)16(22)28-6/h8-9H,1-6H3 |
| InChIKey | QYCKZJKFKNZXGV-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|